C21H28N2O3 — CID 32919258
N-methyl-N-(4-methylcyclohexyl)-4-(5-methyl-1,3-dioxoisoindol-2-yl)butanamide (PubChem CID 32919258) has the molecular formula C21H28N2O3 and a molecular weight of 356.47 g/mol. Its IUPAC name is N-methyl-N-(4-methylcyclohexyl)-4-(5-methyl-1,3-dioxoisoindol-2-yl)butanamide.
| Compound Name | N-methyl-N-(4-methylcyclohexyl)-4-(5-methyl-1,3-dioxoisoindol-2-yl)butanamide |
|---|---|
| PubChem CID | 32919258 |
| Molecular Formula | C21H28N2O3 |
| Molecular Weight | 356.47 g/mol |
| Exact Mass | 356.21 |
| IUPAC Name | N-methyl-N-(4-methylcyclohexyl)-4-(5-methyl-1,3-dioxoisoindol-2-yl)butanamide |
| SMILES | Cc1ccc2c(c1)C(=O)N(CCCC(=O)N(C)C1CCC(C)CC1)C2=O |
| InChI | InChI=1S/C21H28N2O3/c1-14-6-9-16(10-7-14)22(3)19(24)5-4-12-23-20(25)17-11-8-15(2)13-18(17)21(23)26/h8,11,13-14,16H,4-7,9-10,12H2,1-3H3 |
| InChIKey | MAYDVLJLJIROJD-UHFFFAOYSA-N |
| XLogP | 3.41 |
| TPSA | 57.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.47 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|