C20H22N2O3S — CID 51192488
N-methyl-4-(5-methyl-1,3-dioxoisoindol-2-yl)-N-[(3-methylthiophen-2-yl)methyl]butanamide (PubChem CID 51192488) has the molecular formula C20H22N2O3S and a molecular weight of 370.47 g/mol. Its IUPAC name is N-methyl-4-(5-methyl-1,3-dioxoisoindol-2-yl)-N-[(3-methylthiophen-2-yl)methyl]butanamide.
| Compound Name | N-methyl-4-(5-methyl-1,3-dioxoisoindol-2-yl)-N-[(3-methylthiophen-2-yl)methyl]butanamide |
|---|---|
| PubChem CID | 51192488 |
| Molecular Formula | C20H22N2O3S |
| Molecular Weight | 370.47 g/mol |
| Exact Mass | 370.14 |
| IUPAC Name | N-methyl-4-(5-methyl-1,3-dioxoisoindol-2-yl)-N-[(3-methylthiophen-2-yl)methyl]butanamide |
| SMILES | Cc1ccc2c(c1)C(=O)N(CCCC(=O)N(C)Cc1sccc1C)C2=O |
| InChI | InChI=1S/C20H22N2O3S/c1-13-6-7-15-16(11-13)20(25)22(19(15)24)9-4-5-18(23)21(3)12-17-14(2)8-10-26-17/h6-8,10-11H,4-5,9,12H2,1-3H3 |
| InChIKey | DWJSVKITDSCVHW-UHFFFAOYSA-N |
| XLogP | 3.40 |
| TPSA | 57.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.47 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|