C26H31N3O3 — CID 36543812
3-(5-methyl-1,3-dioxoisoindol-2-yl)-N-[[4-[(4-methylpiperidin-1-yl)methyl]phenyl]methyl]propanamide (PubChem CID 36543812) has the molecular formula C26H31N3O3 and a molecular weight of 433.55 g/mol. Its IUPAC name is 3-(5-methyl-1,3-dioxoisoindol-2-yl)-N-[[4-[(4-methylpiperidin-1-yl)methyl]phenyl]methyl]propanamide.
| Compound Name | 3-(5-methyl-1,3-dioxoisoindol-2-yl)-N-[[4-[(4-methylpiperidin-1-yl)methyl]phenyl]methyl]propanamide |
|---|---|
| PubChem CID | 36543812 |
| Molecular Formula | C26H31N3O3 |
| Molecular Weight | 433.55 g/mol |
| Exact Mass | 433.24 |
| IUPAC Name | 3-(5-methyl-1,3-dioxoisoindol-2-yl)-N-[[4-[(4-methylpiperidin-1-yl)methyl]phenyl]methyl]propanamide |
| SMILES | Cc1ccc2c(c1)C(=O)N(CCC(=O)NCc1ccc(CN3CCC(C)CC3)cc1)C2=O |
| InChI | InChI=1S/C26H31N3O3/c1-18-9-12-28(13-10-18)17-21-6-4-20(5-7-21)16-27-24(30)11-14-29-25(31)22-8-3-19(2)15-23(22)26(29)32/h3-8,15,18H,9-14,16-17H2,1-2H3,(H,27,30) |
| InChIKey | CRENCTFFEUVZOT-UHFFFAOYSA-N |
| XLogP | 3.53 |
| TPSA | 69.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.55 |
| LogP ≤ 5 | 3.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|