C22H21ClN2O5 — CID 55395050
N-[(6-chloro-3,4-dihydro-2H-1,5-benzodioxepin-8-yl)methyl]-3-(5-methyl-1,3-dioxoisoindol-2-yl)propanamide (PubChem CID 55395050) has the molecular formula C22H21ClN2O5 and a molecular weight of 428.87 g/mol. Its IUPAC name is N-[(6-chloro-3,4-dihydro-2H-1,5-benzodioxepin-8-yl)methyl]-3-(5-methyl-1,3-dioxoisoindol-2-yl)propanamide.
| Compound Name | N-[(6-chloro-3,4-dihydro-2H-1,5-benzodioxepin-8-yl)methyl]-3-(5-methyl-1,3-dioxoisoindol-2-yl)propanamide |
|---|---|
| PubChem CID | 55395050 |
| Molecular Formula | C22H21ClN2O5 |
| Molecular Weight | 428.87 g/mol |
| Exact Mass | 428.11 |
| IUPAC Name | N-[(6-chloro-3,4-dihydro-2H-1,5-benzodioxepin-8-yl)methyl]-3-(5-methyl-1,3-dioxoisoindol-2-yl)propanamide |
| SMILES | Cc1ccc2c(c1)C(=O)N(CCC(=O)NCc1cc(Cl)c3c(c1)OCCCO3)C2=O |
| InChI | InChI=1S/C22H21ClN2O5/c1-13-3-4-15-16(9-13)22(28)25(21(15)27)6-5-19(26)24-12-14-10-17(23)20-18(11-14)29-7-2-8-30-20/h3-4,9-11H,2,5-8,12H2,1H3,(H,24,26) |
| InChIKey | LTTRIMTUAPDZCB-UHFFFAOYSA-N |
| XLogP | 3.11 |
| TPSA | 84.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.87 |
| LogP ≤ 5 | 3.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|