C11H17NO5S — CID 129026428
methyl 3,4-dioxo-4-[1-(propanoylamino)propan-2-ylsulfanyl]butanoate (PubChem CID 129026428) has the molecular formula C11H17NO5S and a molecular weight of 275.33 g/mol. Its IUPAC name is methyl 3,4-dioxo-4-[1-(propanoylamino)propan-2-ylsulfanyl]butanoate.
| Compound Name | methyl 3,4-dioxo-4-[1-(propanoylamino)propan-2-ylsulfanyl]butanoate |
|---|---|
| PubChem CID | 129026428 |
| Molecular Formula | C11H17NO5S |
| Molecular Weight | 275.33 g/mol |
| Exact Mass | 275.08 |
| IUPAC Name | methyl 3,4-dioxo-4-[1-(propanoylamino)propan-2-ylsulfanyl]butanoate |
| SMILES | CCC(=O)NCC(C)SC(=O)C(=O)CC(=O)OC |
| InChI | InChI=1S/C11H17NO5S/c1-4-9(14)12-6-7(2)18-11(16)8(13)5-10(15)17-3/h7H,4-6H2,1-3H3,(H,12,14) |
| InChIKey | MQVXWHWCMPNWEE-UHFFFAOYSA-N |
| XLogP | 0.29 |
| TPSA | 89.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.33 |
| LogP ≤ 5 | 0.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|