C11H18N2O6 — CID 10378628
methyl 3-[2-[(3-methoxy-3-oxopropanoyl)amino]propylamino]-3-oxopropanoate (PubChem CID 10378628) has the molecular formula C11H18N2O6 and a molecular weight of 274.27 g/mol. Its IUPAC name is methyl 3-[2-[(3-methoxy-3-oxopropanoyl)amino]propylamino]-3-oxopropanoate.
| Compound Name | methyl 3-[2-[(3-methoxy-3-oxopropanoyl)amino]propylamino]-3-oxopropanoate |
|---|---|
| PubChem CID | 10378628 |
| Molecular Formula | C11H18N2O6 |
| Molecular Weight | 274.27 g/mol |
| Exact Mass | 274.12 |
| IUPAC Name | methyl 3-[2-[(3-methoxy-3-oxopropanoyl)amino]propylamino]-3-oxopropanoate |
| SMILES | COC(=O)CC(=O)NCC(C)NC(=O)CC(=O)OC |
| InChI | InChI=1S/C11H18N2O6/c1-7(13-9(15)5-11(17)19-3)6-12-8(14)4-10(16)18-2/h7H,4-6H2,1-3H3,(H,12,14)(H,13,15) |
| InChIKey | LZSOYBNMLOIPLL-UHFFFAOYSA-N |
| XLogP | -1.27 |
| TPSA | 110.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.27 |
| LogP ≤ 5 | -1.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|