C25H28F3N3O4 — CID 129026927
(3R)-3-amino-6-[4-methyl-2-[[5-methyl-2-[4-(trifluoromethoxy)phenyl]imidazol-1-yl]methyl]phenoxy]hexanoic acid (PubChem CID 129026927) has the molecular formula C25H28F3N3O4 and a molecular weight of 491.51 g/mol. Its IUPAC name is (3R)-3-amino-6-[4-methyl-2-[[5-methyl-2-[4-(trifluoromethoxy)phenyl]imidazol-1-yl]methyl]phenoxy]hexanoic acid.
| Compound Name | (3R)-3-amino-6-[4-methyl-2-[[5-methyl-2-[4-(trifluoromethoxy)phenyl]imidazol-1-yl]methyl]phenoxy]hexanoic acid |
|---|---|
| PubChem CID | 129026927 |
| Molecular Formula | C25H28F3N3O4 |
| Molecular Weight | 491.51 g/mol |
| Exact Mass | 491.20 |
| IUPAC Name | (3R)-3-amino-6-[4-methyl-2-[[5-methyl-2-[4-(trifluoromethoxy)phenyl]imidazol-1-yl]methyl]phenoxy]hexanoic acid |
| SMILES | Cc1ccc(OCCC[C@@H](N)CC(=O)O)c(Cn2c(C)cnc2-c2ccc(OC(F)(F)F)cc2)c1 |
| InChI | InChI=1S/C25H28F3N3O4/c1-16-5-10-22(34-11-3-4-20(29)13-23(32)33)19(12-16)15-31-17(2)14-30-24(31)18-6-8-21(9-7-18)35-25(26,27)28/h5-10,12,14,20H,3-4,11,13,15,29H2,1-2H3,(H,32,33)/t20-/m1/s1 |
| InChIKey | CNROEQFNBOHITD-HXUWFJFHSA-N |
| XLogP | 5.07 |
| TPSA | 99.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 491.51 |
| LogP ≤ 5 | 5.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|