C28H33F3N2O4 — CID 148928171
(3R)-3-amino-6-[2-[[2,4-dimethyl-7-[4-(trifluoromethoxy)phenyl]-4,5-dihydroazepin-1-yl]methyl]phenoxy]hexanoic acid (PubChem CID 148928171) has the molecular formula C28H33F3N2O4 and a molecular weight of 518.58 g/mol. Its IUPAC name is (3R)-3-amino-6-[2-[[2,4-dimethyl-7-[4-(trifluoromethoxy)phenyl]-4,5-dihydroazepin-1-yl]methyl]phenoxy]hexanoic acid.
| Compound Name | (3R)-3-amino-6-[2-[[2,4-dimethyl-7-[4-(trifluoromethoxy)phenyl]-4,5-dihydroazepin-1-yl]methyl]phenoxy]hexanoic acid |
|---|---|
| PubChem CID | 148928171 |
| Molecular Formula | C28H33F3N2O4 |
| Molecular Weight | 518.58 g/mol |
| Exact Mass | 518.24 |
| IUPAC Name | (3R)-3-amino-6-[2-[[2,4-dimethyl-7-[4-(trifluoromethoxy)phenyl]-4,5-dihydroazepin-1-yl]methyl]phenoxy]hexanoic acid |
| SMILES | CC1=CC(C)CC=C(c2ccc(OC(F)(F)F)cc2)N1Cc1ccccc1OCCC[C@@H](N)CC(=O)O |
| InChI | InChI=1S/C28H33F3N2O4/c1-19-9-14-25(21-10-12-24(13-11-21)37-28(29,30)31)33(20(2)16-19)18-22-6-3-4-8-26(22)36-15-5-7-23(32)17-27(34)35/h3-4,6,8,10-14,16,19,23H,5,7,9,15,17-18,32H2,1-2H3,(H,34,35)/t19?,23-/m1/s1 |
| InChIKey | PLKFVRRDALSOFH-LEQGEALCSA-N |
| XLogP | 6.33 |
| TPSA | 85.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 518.58 |
| LogP ≤ 5 | 6.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|