C24H29N3O3 — CID 129027008
(3R)-3-amino-6-[2-[[5-methyl-2-(4-methylphenyl)imidazol-1-yl]methyl]phenoxy]hexanoic acid (PubChem CID 129027008) has the molecular formula C24H29N3O3 and a molecular weight of 407.51 g/mol. Its IUPAC name is (3R)-3-amino-6-[2-[[5-methyl-2-(4-methylphenyl)imidazol-1-yl]methyl]phenoxy]hexanoic acid.
| Compound Name | (3R)-3-amino-6-[2-[[5-methyl-2-(4-methylphenyl)imidazol-1-yl]methyl]phenoxy]hexanoic acid |
|---|---|
| PubChem CID | 129027008 |
| Molecular Formula | C24H29N3O3 |
| Molecular Weight | 407.51 g/mol |
| Exact Mass | 407.22 |
| IUPAC Name | (3R)-3-amino-6-[2-[[5-methyl-2-(4-methylphenyl)imidazol-1-yl]methyl]phenoxy]hexanoic acid |
| SMILES | Cc1ccc(-c2ncc(C)n2Cc2ccccc2OCCC[C@@H](N)CC(=O)O)cc1 |
| InChI | InChI=1S/C24H29N3O3/c1-17-9-11-19(12-10-17)24-26-15-18(2)27(24)16-20-6-3-4-8-22(20)30-13-5-7-21(25)14-23(28)29/h3-4,6,8-12,15,21H,5,7,13-14,16,25H2,1-2H3,(H,28,29)/t21-/m1/s1 |
| InChIKey | DPVVPNAJWAKTCW-OAQYLSRUSA-N |
| XLogP | 4.18 |
| TPSA | 90.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.51 |
| LogP ≤ 5 | 4.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|