C28H32N2O4 — CID 121269552
ethyl 6-[2-[[5-methyl-2-(2-methyl-1-benzofuran-5-yl)imidazol-1-yl]methyl]phenoxy]hexanoate (PubChem CID 121269552) has the molecular formula C28H32N2O4 and a molecular weight of 460.57 g/mol. Its IUPAC name is ethyl 6-[2-[[5-methyl-2-(2-methyl-1-benzofuran-5-yl)imidazol-1-yl]methyl]phenoxy]hexanoate.
| Compound Name | ethyl 6-[2-[[5-methyl-2-(2-methyl-1-benzofuran-5-yl)imidazol-1-yl]methyl]phenoxy]hexanoate |
|---|---|
| PubChem CID | 121269552 |
| Molecular Formula | C28H32N2O4 |
| Molecular Weight | 460.57 g/mol |
| Exact Mass | 460.24 |
| IUPAC Name | ethyl 6-[2-[[5-methyl-2-(2-methyl-1-benzofuran-5-yl)imidazol-1-yl]methyl]phenoxy]hexanoate |
| SMILES | CCOC(=O)CCCCCOc1ccccc1Cn1c(C)cnc1-c1ccc2oc(C)cc2c1 |
| InChI | InChI=1S/C28H32N2O4/c1-4-32-27(31)12-6-5-9-15-33-25-11-8-7-10-23(25)19-30-20(2)18-29-28(30)22-13-14-26-24(17-22)16-21(3)34-26/h7-8,10-11,13-14,16-18H,4-6,9,12,15,19H2,1-3H3 |
| InChIKey | CRRRMMOVFQQPGF-UHFFFAOYSA-N |
| XLogP | 6.46 |
| TPSA | 66.49 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.57 |
| LogP ≤ 5 | 6.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|