C26H28N2O4 — CID 121270316
6-[2-[dideuterio-[5-methyl-2-(2-methyl-1-benzofuran-5-yl)imidazol-1-yl]methyl]phenoxy]hexanoic acid (PubChem CID 121270316) has the molecular formula C26H28N2O4 and a molecular weight of 434.53 g/mol. Its IUPAC name is 6-[2-[dideuterio-[5-methyl-2-(2-methyl-1-benzofuran-5-yl)imidazol-1-yl]methyl]phenoxy]hexanoic acid.
| Compound Name | 6-[2-[dideuterio-[5-methyl-2-(2-methyl-1-benzofuran-5-yl)imidazol-1-yl]methyl]phenoxy]hexanoic acid |
|---|---|
| PubChem CID | 121270316 |
| Molecular Formula | C26H28N2O4 |
| Molecular Weight | 434.53 g/mol |
| Exact Mass | 434.22 |
| IUPAC Name | 6-[2-[dideuterio-[5-methyl-2-(2-methyl-1-benzofuran-5-yl)imidazol-1-yl]methyl]phenoxy]hexanoic acid |
| SMILES | [2H]C([2H])(c1ccccc1OCCCCCC(=O)O)n1c(C)cnc1-c1ccc2oc(C)cc2c1 |
| InChI | InChI=1S/C26H28N2O4/c1-18-16-27-26(20-11-12-24-22(15-20)14-19(2)32-24)28(18)17-21-8-5-6-9-23(21)31-13-7-3-4-10-25(29)30/h5-6,8-9,11-12,14-16H,3-4,7,10,13,17H2,1-2H3,(H,29,30)/i17D2 |
| InChIKey | AUWIMRZAPWIYPE-FBCWWBABSA-N |
| XLogP | 5.99 |
| TPSA | 77.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.53 |
| LogP ≤ 5 | 5.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|