C25H29ClFN3O3 — CID 129026941
ethyl (3R)-3-amino-6-[2-[[2-(4-chloro-3-fluorophenyl)-5-methylimidazol-1-yl]methyl]phenoxy]hexanoate (PubChem CID 129026941) has the molecular formula C25H29ClFN3O3 and a molecular weight of 473.98 g/mol. Its IUPAC name is ethyl (3R)-3-amino-6-[2-[[2-(4-chloro-3-fluorophenyl)-5-methylimidazol-1-yl]methyl]phenoxy]hexanoate.
| Compound Name | ethyl (3R)-3-amino-6-[2-[[2-(4-chloro-3-fluorophenyl)-5-methylimidazol-1-yl]methyl]phenoxy]hexanoate |
|---|---|
| PubChem CID | 129026941 |
| Molecular Formula | C25H29ClFN3O3 |
| Molecular Weight | 473.98 g/mol |
| Exact Mass | 473.19 |
| IUPAC Name | ethyl (3R)-3-amino-6-[2-[[2-(4-chloro-3-fluorophenyl)-5-methylimidazol-1-yl]methyl]phenoxy]hexanoate |
| SMILES | CCOC(=O)C[C@H](N)CCCOc1ccccc1Cn1c(C)cnc1-c1ccc(Cl)c(F)c1 |
| InChI | InChI=1S/C25H29ClFN3O3/c1-3-32-24(31)14-20(28)8-6-12-33-23-9-5-4-7-19(23)16-30-17(2)15-29-25(30)18-10-11-21(26)22(27)13-18/h4-5,7,9-11,13,15,20H,3,6,8,12,14,16,28H2,1-2H3/t20-/m1/s1 |
| InChIKey | IQFLHRCNBYDDKP-HXUWFJFHSA-N |
| XLogP | 5.14 |
| TPSA | 79.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 473.98 |
| LogP ≤ 5 | 5.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|