C27H30F4N2O3 — CID 129027012
ethyl (3R)-6-[4-fluoro-2-[[5-methyl-2-[4-(trifluoromethyl)phenyl]imidazol-1-yl]methyl]phenoxy]-3-methylhexanoate (PubChem CID 129027012) has the molecular formula C27H30F4N2O3 and a molecular weight of 506.54 g/mol. Its IUPAC name is ethyl (3R)-6-[4-fluoro-2-[[5-methyl-2-[4-(trifluoromethyl)phenyl]imidazol-1-yl]methyl]phenoxy]-3-methylhexanoate.
| Compound Name | ethyl (3R)-6-[4-fluoro-2-[[5-methyl-2-[4-(trifluoromethyl)phenyl]imidazol-1-yl]methyl]phenoxy]-3-methylhexanoate |
|---|---|
| PubChem CID | 129027012 |
| Molecular Formula | C27H30F4N2O3 |
| Molecular Weight | 506.54 g/mol |
| Exact Mass | 506.22 |
| IUPAC Name | ethyl (3R)-6-[4-fluoro-2-[[5-methyl-2-[4-(trifluoromethyl)phenyl]imidazol-1-yl]methyl]phenoxy]-3-methylhexanoate |
| SMILES | CCOC(=O)C[C@H](C)CCCOc1ccc(F)cc1Cn1c(C)cnc1-c1ccc(C(F)(F)F)cc1 |
| InChI | InChI=1S/C27H30F4N2O3/c1-4-35-25(34)14-18(2)6-5-13-36-24-12-11-23(28)15-21(24)17-33-19(3)16-32-26(33)20-7-9-22(10-8-20)27(29,30)31/h7-12,15-16,18H,4-6,13-14,17H2,1-3H3/t18-/m1/s1 |
| InChIKey | HPBUQMJVWYSCQS-GOSISDBHSA-N |
| XLogP | 6.81 |
| TPSA | 53.35 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 506.54 |
| LogP ≤ 5 | 6.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|