C25H29BrN2O3 — CID 121269677
ethyl 6-[3-[[2-(4-bromophenyl)-5-methylimidazol-1-yl]methyl]phenoxy]hexanoate (PubChem CID 121269677) has the molecular formula C25H29BrN2O3 and a molecular weight of 485.42 g/mol. Its IUPAC name is ethyl 6-[3-[[2-(4-bromophenyl)-5-methylimidazol-1-yl]methyl]phenoxy]hexanoate.
| Compound Name | ethyl 6-[3-[[2-(4-bromophenyl)-5-methylimidazol-1-yl]methyl]phenoxy]hexanoate |
|---|---|
| PubChem CID | 121269677 |
| Molecular Formula | C25H29BrN2O3 |
| Molecular Weight | 485.42 g/mol |
| Exact Mass | 484.14 |
| IUPAC Name | ethyl 6-[3-[[2-(4-bromophenyl)-5-methylimidazol-1-yl]methyl]phenoxy]hexanoate |
| SMILES | CCOC(=O)CCCCCOc1cccc(Cn2c(C)cnc2-c2ccc(Br)cc2)c1 |
| InChI | InChI=1S/C25H29BrN2O3/c1-3-30-24(29)10-5-4-6-15-31-23-9-7-8-20(16-23)18-28-19(2)17-27-25(28)21-11-13-22(26)14-12-21/h7-9,11-14,16-17H,3-6,10,15,18H2,1-2H3 |
| InChIKey | WIEUGWKTFLQOMI-UHFFFAOYSA-N |
| XLogP | 6.17 |
| TPSA | 53.35 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 485.42 |
| LogP ≤ 5 | 6.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|