C27H27N3O5 — CID 139827146
ethyl 5-[4-(1-benzyl-6-nitrobenzimidazol-2-yl)phenoxy]pentanoate (PubChem CID 139827146) has the molecular formula C27H27N3O5 and a molecular weight of 473.53 g/mol. Its IUPAC name is ethyl 5-[4-(1-benzyl-6-nitrobenzimidazol-2-yl)phenoxy]pentanoate.
| Compound Name | ethyl 5-[4-(1-benzyl-6-nitrobenzimidazol-2-yl)phenoxy]pentanoate |
|---|---|
| PubChem CID | 139827146 |
| Molecular Formula | C27H27N3O5 |
| Molecular Weight | 473.53 g/mol |
| Exact Mass | 473.20 |
| IUPAC Name | ethyl 5-[4-(1-benzyl-6-nitrobenzimidazol-2-yl)phenoxy]pentanoate |
| SMILES | CCOC(=O)CCCCOc1ccc(-c2nc3ccc([N+](=O)[O-])cc3n2Cc2ccccc2)cc1 |
| InChI | InChI=1S/C27H27N3O5/c1-2-34-26(31)10-6-7-17-35-23-14-11-21(12-15-23)27-28-24-16-13-22(30(32)33)18-25(24)29(27)19-20-8-4-3-5-9-20/h3-5,8-9,11-16,18H,2,6-7,10,17,19H2,1H3 |
| InChIKey | YCYCRILKMYSJDS-UHFFFAOYSA-N |
| XLogP | 5.77 |
| TPSA | 96.49 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 473.53 |
| LogP ≤ 5 | 5.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|