C24H29F6N3O3 — CID 162620378
(3R)-3-amino-6-[2-[[5-(trifluoromethyl)-2-[4-(trifluoromethyl)cyclohexyl]imidazol-1-yl]methyl]phenoxy]hexanoic acid (PubChem CID 162620378) has the molecular formula C24H29F6N3O3 and a molecular weight of 521.50 g/mol. Its IUPAC name is (3R)-3-amino-6-[2-[[5-(trifluoromethyl)-2-[4-(trifluoromethyl)cyclohexyl]imidazol-1-yl]methyl]phenoxy]hexanoic acid.
| Compound Name | (3R)-3-amino-6-[2-[[5-(trifluoromethyl)-2-[4-(trifluoromethyl)cyclohexyl]imidazol-1-yl]methyl]phenoxy]hexanoic acid |
|---|---|
| PubChem CID | 162620378 |
| Molecular Formula | C24H29F6N3O3 |
| Molecular Weight | 521.50 g/mol |
| Exact Mass | 521.21 |
| IUPAC Name | (3R)-3-amino-6-[2-[[5-(trifluoromethyl)-2-[4-(trifluoromethyl)cyclohexyl]imidazol-1-yl]methyl]phenoxy]hexanoic acid |
| SMILES | N[C@H](CCCOc1ccccc1Cn1c(C(F)(F)F)cnc1C1CCC(C(F)(F)F)CC1)CC(=O)O |
| InChI | InChI=1S/C24H29F6N3O3/c25-23(26,27)17-9-7-15(8-10-17)22-32-13-20(24(28,29)30)33(22)14-16-4-1-2-6-19(16)36-11-3-5-18(31)12-21(34)35/h1-2,4,6,13,15,17-18H,3,5,7-12,14,31H2,(H,34,35)/t15?,17?,18-/m1/s1 |
| InChIKey | XRIITCAZGSIPDP-VMWRSERWSA-N |
| XLogP | 5.75 |
| TPSA | 90.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 521.50 |
| LogP ≤ 5 | 5.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|