C29H34N4O9S — CID 129027471
2-[4-[3-[2-[5-[(3aS,4S,6aR)-2-oxo-1,3,3a,4,6,6a-hexahydrothieno[3,4-d]imidazol-4-yl]pentanoylamino]ethylcarbamoyl]-5-(carboxymethoxy)phenyl]phenoxy]acetic acid (PubChem CID 129027471) has the molecular formula C29H34N4O9S and a molecular weight of 614.68 g/mol. Its IUPAC name is 2-[4-[3-[2-[5-[(3aS,4S,6aR)-2-oxo-1,3,3a,4,6,6a-hexahydrothieno[3,4-d]imidazol-4-yl]pentanoylamino]ethylcarbamoyl]-5-(carboxymethoxy)phenyl]phenoxy]acetic acid.
| Compound Name | 2-[4-[3-[2-[5-[(3aS,4S,6aR)-2-oxo-1,3,3a,4,6,6a-hexahydrothieno[3,4-d]imidazol-4-yl]pentanoylamino]ethylcarbamoyl]-5-(carboxymethoxy)phenyl]phenoxy]acetic acid |
|---|---|
| PubChem CID | 129027471 |
| Molecular Formula | C29H34N4O9S |
| Molecular Weight | 614.68 g/mol |
| Exact Mass | 614.20 |
| IUPAC Name | 2-[4-[3-[2-[5-[(3aS,4S,6aR)-2-oxo-1,3,3a,4,6,6a-hexahydrothieno[3,4-d]imidazol-4-yl]pentanoylamino]ethylcarbamoyl]-5-(carboxymethoxy)phenyl]phenoxy]acetic acid |
| SMILES | O=C(O)COc1ccc(-c2cc(OCC(=O)O)cc(C(=O)NCCNC(=O)CCCC[C@@H]3SC[C@@H]4NC(=O)N[C@@H]43)c2)cc1 |
| InChI | InChI=1S/C29H34N4O9S/c34-24(4-2-1-3-23-27-22(16-43-23)32-29(40)33-27)30-9-10-31-28(39)19-11-18(12-21(13-19)42-15-26(37)38)17-5-7-20(8-6-17)41-14-25(35)36/h5-8,11-13,22-23,27H,1-4,9-10,14-16H2,(H,30,34)(H,31,39)(H,35,36)(H,37,38)(H2,32,33,40)/t22-,23-,27-/m0/s1 |
| InChIKey | YZWCOQRUGVGROS-WCYRKSIYSA-N |
| XLogP | 1.85 |
| TPSA | 192.39 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 614.68 |
| LogP ≤ 5 | 1.85 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'biotin_analogue', 'substructure': 'N/A'} |
|---|