C23H34N4O6S — CID 170896762
N-[6-[5-[(3aS,4S,6aR)-2-oxo-1,3,3a,4,6,6a-hexahydrothieno[3,4-d]imidazol-4-yl]pentanoylamino]hexyl]-3,4,5-trihydroxybenzamide (PubChem CID 170896762) has the molecular formula C23H34N4O6S and a molecular weight of 494.61 g/mol. Its IUPAC name is N-[6-[5-[(3aS,4S,6aR)-2-oxo-1,3,3a,4,6,6a-hexahydrothieno[3,4-d]imidazol-4-yl]pentanoylamino]hexyl]-3,4,5-trihydroxybenzamide.
| Compound Name | N-[6-[5-[(3aS,4S,6aR)-2-oxo-1,3,3a,4,6,6a-hexahydrothieno[3,4-d]imidazol-4-yl]pentanoylamino]hexyl]-3,4,5-trihydroxybenzamide |
|---|---|
| PubChem CID | 170896762 |
| Molecular Formula | C23H34N4O6S |
| Molecular Weight | 494.61 g/mol |
| Exact Mass | 494.22 |
| IUPAC Name | N-[6-[5-[(3aS,4S,6aR)-2-oxo-1,3,3a,4,6,6a-hexahydrothieno[3,4-d]imidazol-4-yl]pentanoylamino]hexyl]-3,4,5-trihydroxybenzamide |
| SMILES | O=C(CCCC[C@@H]1SC[C@@H]2NC(=O)N[C@@H]21)NCCCCCCNC(=O)c1cc(O)c(O)c(O)c1 |
| InChI | InChI=1S/C23H34N4O6S/c28-16-11-14(12-17(29)21(16)31)22(32)25-10-6-2-1-5-9-24-19(30)8-4-3-7-18-20-15(13-34-18)26-23(33)27-20/h11-12,15,18,20,28-29,31H,1-10,13H2,(H,24,30)(H,25,32)(H2,26,27,33)/t15-,18-,20-/m0/s1 |
| InChIKey | PCQJNMJLJDZGNM-QSFXBCCZSA-N |
| XLogP | 1.94 |
| TPSA | 160.02 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 494.61 |
| LogP ≤ 5 | 1.94 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'biotin_analogue', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|