C28H23Cl2FN4O3 — CID 129028613
4-[(6'S,6'aS)-6-chloro-6'-(3-chloro-2-fluorophenyl)-4'-ethyl-2-oxospiro[1H-indole-3,5'-3,3a,6,6a-tetrahydropyrrolo[3,2-b]pyrrole]-2'-yl]-3-aminobenzoic acid (PubChem CID 129028613) has the molecular formula C28H23Cl2FN4O3 and a molecular weight of 553.42 g/mol. Its IUPAC name is 4-[(6'S,6'aS)-6-chloro-6'-(3-chloro-2-fluorophenyl)-4'-ethyl-2-oxospiro[1H-indole-3,5'-3,3a,6,6a-tetrahydropyrrolo[3,2-b]pyrrole]-2'-yl]-3-aminobenzoic acid.
| Compound Name | 4-[(6'S,6'aS)-6-chloro-6'-(3-chloro-2-fluorophenyl)-4'-ethyl-2-oxospiro[1H-indole-3,5'-3,3a,6,6a-tetrahydropyrrolo[3,2-b]pyrrole]-2'-yl]-3-aminobenzoic acid |
|---|---|
| PubChem CID | 129028613 |
| Molecular Formula | C28H23Cl2FN4O3 |
| Molecular Weight | 553.42 g/mol |
| Exact Mass | 552.11 |
| IUPAC Name | 4-[(6'S,6'aS)-6-chloro-6'-(3-chloro-2-fluorophenyl)-4'-ethyl-2-oxospiro[1H-indole-3,5'-3,3a,6,6a-tetrahydropyrrolo[3,2-b]pyrrole]-2'-yl]-3-aminobenzoic acid |
| SMILES | CCN1C2CC(c3ccc(C(=O)O)cc3N)=N[C@H]2[C@H](c2cccc(Cl)c2F)C12C(=O)Nc1cc(Cl)ccc12 |
| InChI | InChI=1S/C28H23Cl2FN4O3/c1-2-35-22-12-20(15-8-6-13(26(36)37)10-19(15)32)33-25(22)23(16-4-3-5-18(30)24(16)31)28(35)17-9-7-14(29)11-21(17)34-27(28)38/h3-11,22-23,25H,2,12,32H2,1H3,(H,34,38)(H,36,37)/t22?,23-,25+,28?/m0/s1 |
| InChIKey | YFKHLEHEKZJAAH-OVBKBZFMSA-N |
| XLogP | 5.31 |
| TPSA | 108.02 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 553.42 |
| LogP ≤ 5 | 5.31 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|