C27H21Cl2FN4O4 — CID 129028618
4-[(3S,6'S,6'aS)-6-chloro-6'-(3-chloro-2-fluorophenyl)-4'-ethyl-2-oxospiro[1H-indole-3,5'-6,6a-dihydro-3aH-pyrrolo[3,2-d][1,3]oxazole]-2'-yl]-3-aminobenzoic acid (PubChem CID 129028618) has the molecular formula C27H21Cl2FN4O4 and a molecular weight of 555.39 g/mol. Its IUPAC name is 4-[(3S,6'S,6'aS)-6-chloro-6'-(3-chloro-2-fluorophenyl)-4'-ethyl-2-oxospiro[1H-indole-3,5'-6,6a-dihydro-3aH-pyrrolo[3,2-d][1,3]oxazole]-2'-yl]-3-aminobenzoic acid.
| Compound Name | 4-[(3S,6'S,6'aS)-6-chloro-6'-(3-chloro-2-fluorophenyl)-4'-ethyl-2-oxospiro[1H-indole-3,5'-6,6a-dihydro-3aH-pyrrolo[3,2-d][1,3]oxazole]-2'-yl]-3-aminobenzoic acid |
|---|---|
| PubChem CID | 129028618 |
| Molecular Formula | C27H21Cl2FN4O4 |
| Molecular Weight | 555.39 g/mol |
| Exact Mass | 554.09 |
| IUPAC Name | 4-[(3S,6'S,6'aS)-6-chloro-6'-(3-chloro-2-fluorophenyl)-4'-ethyl-2-oxospiro[1H-indole-3,5'-6,6a-dihydro-3aH-pyrrolo[3,2-d][1,3]oxazole]-2'-yl]-3-aminobenzoic acid |
| SMILES | CCN1C2OC(c3ccc(C(=O)O)cc3N)=N[C@H]2[C@H](c2cccc(Cl)c2F)[C@]12C(=O)Nc1cc(Cl)ccc12 |
| InChI | InChI=1S/C27H21Cl2FN4O4/c1-2-34-24-22(33-23(38-24)14-8-6-12(25(35)36)10-18(14)31)20(15-4-3-5-17(29)21(15)30)27(34)16-9-7-13(28)11-19(16)32-26(27)37/h3-11,20,22,24H,2,31H2,1H3,(H,32,37)(H,35,36)/t20-,22-,24?,27+/m0/s1 |
| InChIKey | NVTMFBMZNDAUAM-UXOMFQOJSA-N |
| XLogP | 4.85 |
| TPSA | 117.25 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 555.39 |
| LogP ≤ 5 | 4.85 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|