C29H27Cl2FN4O2 — CID 163553967
(3S,3'aS,6'S,6'aS)-2'-(2-amino-4-hydroxyphenyl)-6-chloro-6'-(3-chloro-2-fluorophenyl)-4'-(2-methylpropyl)spiro[1H-indole-3,5'-3,3a,6,6a-tetrahydropyrrolo[3,2-b]pyrrole]-2-one (PubChem CID 163553967) has the molecular formula C29H27Cl2FN4O2 and a molecular weight of 553.47 g/mol. Its IUPAC name is (3S,3'aS,6'S,6'aS)-2'-(2-amino-4-hydroxyphenyl)-6-chloro-6'-(3-chloro-2-fluorophenyl)-4'-(2-methylpropyl)spiro[1H-indole-3,5'-3,3a,6,6a-tetrahydropyrrolo[3,2-b]pyrrole]-2-one.
| Compound Name | (3S,3'aS,6'S,6'aS)-2'-(2-amino-4-hydroxyphenyl)-6-chloro-6'-(3-chloro-2-fluorophenyl)-4'-(2-methylpropyl)spiro[1H-indole-3,5'-3,3a,6,6a-tetrahydropyrrolo[3,2-b]pyrrole]-2-one |
|---|---|
| PubChem CID | 163553967 |
| Molecular Formula | C29H27Cl2FN4O2 |
| Molecular Weight | 553.47 g/mol |
| Exact Mass | 552.15 |
| IUPAC Name | (3S,3'aS,6'S,6'aS)-2'-(2-amino-4-hydroxyphenyl)-6-chloro-6'-(3-chloro-2-fluorophenyl)-4'-(2-methylpropyl)spiro[1H-indole-3,5'-3,3a,6,6a-tetrahydropyrrolo[3,2-b]pyrrole]-2-one |
| SMILES | CC(C)CN1[C@H]2CC(c3ccc(O)cc3N)=N[C@H]2[C@H](c2cccc(Cl)c2F)[C@]12C(=O)Nc1cc(Cl)ccc12 |
| InChI | InChI=1S/C29H27Cl2FN4O2/c1-14(2)13-36-24-12-22(17-8-7-16(37)11-21(17)33)34-27(24)25(18-4-3-5-20(31)26(18)32)29(36)19-9-6-15(30)10-23(19)35-28(29)38/h3-11,14,24-25,27,37H,12-13,33H2,1-2H3,(H,35,38)/t24-,25-,27+,29+/m0/s1 |
| InChIKey | UVJAIJFRNVFRBK-OFPSWZBWSA-N |
| XLogP | 5.95 |
| TPSA | 90.95 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 553.47 |
| LogP ≤ 5 | 5.95 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|