C12H24N2 — CID 129028845
4-hex-1-en-2-yl-1,2-dimethylpiperazine (PubChem CID 129028845) has the molecular formula C12H24N2 and a molecular weight of 196.34 g/mol. Its IUPAC name is 4-hex-1-en-2-yl-1,2-dimethylpiperazine.
| Compound Name | 4-hex-1-en-2-yl-1,2-dimethylpiperazine |
|---|---|
| PubChem CID | 129028845 |
| Molecular Formula | C12H24N2 |
| Molecular Weight | 196.34 g/mol |
| Exact Mass | 196.19 |
| IUPAC Name | 4-hex-1-en-2-yl-1,2-dimethylpiperazine |
| SMILES | C=C(CCCC)N1CCN(C)C(C)C1 |
| InChI | InChI=1S/C12H24N2/c1-5-6-7-11(2)14-9-8-13(4)12(3)10-14/h12H,2,5-10H2,1,3-4H3 |
| InChIKey | VKSGZIQZVKTCLO-UHFFFAOYSA-N |
| XLogP | 2.33 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 196.34 |
| LogP ≤ 5 | 2.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |