C11H22N2 — CID 129029243
1,2-dimethyl-4-pent-1-en-2-ylpiperazine (PubChem CID 129029243) has the molecular formula C11H22N2 and a molecular weight of 182.31 g/mol. Its IUPAC name is 1,2-dimethyl-4-pent-1-en-2-ylpiperazine.
| Compound Name | 1,2-dimethyl-4-pent-1-en-2-ylpiperazine |
|---|---|
| PubChem CID | 129029243 |
| Molecular Formula | C11H22N2 |
| Molecular Weight | 182.31 g/mol |
| Exact Mass | 182.18 |
| IUPAC Name | 1,2-dimethyl-4-pent-1-en-2-ylpiperazine |
| SMILES | C=C(CCC)N1CCN(C)C(C)C1 |
| InChI | InChI=1S/C11H22N2/c1-5-6-10(2)13-8-7-12(4)11(3)9-13/h11H,2,5-9H2,1,3-4H3 |
| InChIKey | IGWRNAAPUUKKGI-UHFFFAOYSA-N |
| XLogP | 1.94 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 182.31 |
| LogP ≤ 5 | 1.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |