C28H30ClN5 — CID 129029085
4-chloro-2-(1-methylindazol-6-yl)-7-[1-(4-pent-1-en-2-ylpiperazin-1-yl)ethenyl]quinoline (PubChem CID 129029085) has the molecular formula C28H30ClN5 and a molecular weight of 472.04 g/mol. Its IUPAC name is 4-chloro-2-(1-methylindazol-6-yl)-7-[1-(4-pent-1-en-2-ylpiperazin-1-yl)ethenyl]quinoline.
| Compound Name | 4-chloro-2-(1-methylindazol-6-yl)-7-[1-(4-pent-1-en-2-ylpiperazin-1-yl)ethenyl]quinoline |
|---|---|
| PubChem CID | 129029085 |
| Molecular Formula | C28H30ClN5 |
| Molecular Weight | 472.04 g/mol |
| Exact Mass | 471.22 |
| IUPAC Name | 4-chloro-2-(1-methylindazol-6-yl)-7-[1-(4-pent-1-en-2-ylpiperazin-1-yl)ethenyl]quinoline |
| SMILES | C=C(CCC)N1CCN(C(=C)c2ccc3c(Cl)cc(-c4ccc5cnn(C)c5c4)nc3c2)CC1 |
| InChI | InChI=1S/C28H30ClN5/c1-5-6-19(2)33-11-13-34(14-12-33)20(3)21-9-10-24-25(29)17-26(31-27(24)15-21)22-7-8-23-18-30-32(4)28(23)16-22/h7-10,15-18H,2-3,5-6,11-14H2,1,4H3 |
| InChIKey | INCIAFVJXUUQCI-UHFFFAOYSA-N |
| XLogP | 6.34 |
| TPSA | 37.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.04 |
| LogP ≤ 5 | 6.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |