C29H34ClN3 — CID 129029015
4-chloro-3-ethyl-7-[1-(4-hex-1-en-2-ylpiperazin-1-yl)ethenyl]-2-phenylquinoline (PubChem CID 129029015) has the molecular formula C29H34ClN3 and a molecular weight of 460.07 g/mol. Its IUPAC name is 4-chloro-3-ethyl-7-[1-(4-hex-1-en-2-ylpiperazin-1-yl)ethenyl]-2-phenylquinoline.
| Compound Name | 4-chloro-3-ethyl-7-[1-(4-hex-1-en-2-ylpiperazin-1-yl)ethenyl]-2-phenylquinoline |
|---|---|
| PubChem CID | 129029015 |
| Molecular Formula | C29H34ClN3 |
| Molecular Weight | 460.07 g/mol |
| Exact Mass | 459.24 |
| IUPAC Name | 4-chloro-3-ethyl-7-[1-(4-hex-1-en-2-ylpiperazin-1-yl)ethenyl]-2-phenylquinoline |
| SMILES | C=C(CCCC)N1CCN(C(=C)c2ccc3c(Cl)c(CC)c(-c4ccccc4)nc3c2)CC1 |
| InChI | InChI=1S/C29H34ClN3/c1-5-7-11-21(3)32-16-18-33(19-17-32)22(4)24-14-15-26-27(20-24)31-29(25(6-2)28(26)30)23-12-9-8-10-13-23/h8-10,12-15,20H,3-7,11,16-19H2,1-2H3 |
| InChIKey | UNVWFIKOTQKTTL-UHFFFAOYSA-N |
| XLogP | 7.41 |
| TPSA | 19.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.07 |
| LogP ≤ 5 | 7.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |