C32H38ClN5 — CID 129029199
N-[(1Z)-1-[9-chloro-6-[1-(4-hex-1-en-2-ylpiperazin-1-yl)ethenyl]-1,2,3,4-tetrahydroacridin-3-yl]buta-1,3-dienyl]ethanimidoyl cyanide (PubChem CID 129029199) has the molecular formula C32H38ClN5 and a molecular weight of 528.14 g/mol. Its IUPAC name is N-[(1Z)-1-[9-chloro-6-[1-(4-hex-1-en-2-ylpiperazin-1-yl)ethenyl]-1,2,3,4-tetrahydroacridin-3-yl]buta-1,3-dienyl]ethanimidoyl cyanide.
| Compound Name | N-[(1Z)-1-[9-chloro-6-[1-(4-hex-1-en-2-ylpiperazin-1-yl)ethenyl]-1,2,3,4-tetrahydroacridin-3-yl]buta-1,3-dienyl]ethanimidoyl cyanide |
|---|---|
| PubChem CID | 129029199 |
| Molecular Formula | C32H38ClN5 |
| Molecular Weight | 528.14 g/mol |
| Exact Mass | 527.28 |
| IUPAC Name | N-[(1Z)-1-[9-chloro-6-[1-(4-hex-1-en-2-ylpiperazin-1-yl)ethenyl]-1,2,3,4-tetrahydroacridin-3-yl]buta-1,3-dienyl]ethanimidoyl cyanide |
| SMILES | C=C/C=C(\N=C(/C)C#N)C1CCc2c(nc3cc(C(=C)N4CCN(C(=C)CCCC)CC4)ccc3c2Cl)C1 |
| InChI | InChI=1S/C32H38ClN5/c1-6-8-10-23(4)37-15-17-38(18-16-37)24(5)25-11-13-27-30(19-25)36-31-20-26(12-14-28(31)32(27)33)29(9-7-2)35-22(3)21-34/h7,9,11,13,19,26H,2,4-6,8,10,12,14-18,20H2,1,3H3/b29-9-,35-22+ |
| InChIKey | PDLPQFCDLQYQOI-JBOFUXQKSA-N |
| XLogP | 7.34 |
| TPSA | 55.52 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 528.14 |
| LogP ≤ 5 | 7.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|