C27H31ClN4 — CID 129029287
4-[4-chloro-7-[1-(4-hex-1-en-2-ylpiperazin-1-yl)ethenyl]quinolin-2-yl]aniline (PubChem CID 129029287) has the molecular formula C27H31ClN4 and a molecular weight of 447.03 g/mol. Its IUPAC name is 4-[4-chloro-7-[1-(4-hex-1-en-2-ylpiperazin-1-yl)ethenyl]quinolin-2-yl]aniline.
| Compound Name | 4-[4-chloro-7-[1-(4-hex-1-en-2-ylpiperazin-1-yl)ethenyl]quinolin-2-yl]aniline |
|---|---|
| PubChem CID | 129029287 |
| Molecular Formula | C27H31ClN4 |
| Molecular Weight | 447.03 g/mol |
| Exact Mass | 446.22 |
| IUPAC Name | 4-[4-chloro-7-[1-(4-hex-1-en-2-ylpiperazin-1-yl)ethenyl]quinolin-2-yl]aniline |
| SMILES | C=C(CCCC)N1CCN(C(=C)c2ccc3c(Cl)cc(-c4ccc(N)cc4)nc3c2)CC1 |
| InChI | InChI=1S/C27H31ClN4/c1-4-5-6-19(2)31-13-15-32(16-14-31)20(3)22-9-12-24-25(28)18-26(30-27(24)17-22)21-7-10-23(29)11-8-21/h7-12,17-18H,2-6,13-16,29H2,1H3 |
| InChIKey | IVCKYQOHYQSJPV-UHFFFAOYSA-N |
| XLogP | 6.43 |
| TPSA | 45.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.03 |
| LogP ≤ 5 | 6.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|