C23H25ClN6O3 — CID 145292179
butyl 4-[2-(2-aminopyrimidin-5-yl)-4-chloroquinoline-7-carbonyl]piperazine-1-carboxylate (PubChem CID 145292179) has the molecular formula C23H25ClN6O3 and a molecular weight of 468.95 g/mol. Its IUPAC name is butyl 4-[2-(2-aminopyrimidin-5-yl)-4-chloroquinoline-7-carbonyl]piperazine-1-carboxylate.
| Compound Name | butyl 4-[2-(2-aminopyrimidin-5-yl)-4-chloroquinoline-7-carbonyl]piperazine-1-carboxylate |
|---|---|
| PubChem CID | 145292179 |
| Molecular Formula | C23H25ClN6O3 |
| Molecular Weight | 468.95 g/mol |
| Exact Mass | 468.17 |
| IUPAC Name | butyl 4-[2-(2-aminopyrimidin-5-yl)-4-chloroquinoline-7-carbonyl]piperazine-1-carboxylate |
| SMILES | CCCCOC(=O)N1CCN(C(=O)c2ccc3c(Cl)cc(-c4cnc(N)nc4)nc3c2)CC1 |
| InChI | InChI=1S/C23H25ClN6O3/c1-2-3-10-33-23(32)30-8-6-29(7-9-30)21(31)15-4-5-17-18(24)12-19(28-20(17)11-15)16-13-26-22(25)27-14-16/h4-5,11-14H,2-3,6-10H2,1H3,(H2,25,26,27) |
| InChIKey | RHNNWJCWLWNQAQ-UHFFFAOYSA-N |
| XLogP | 3.62 |
| TPSA | 114.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.95 |
| LogP ≤ 5 | 3.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|