C24H24ClIN4O3 — CID 129029139
3-iodopropyl 4-[2-(2-aminophenyl)-4-chloroquinoline-7-carbonyl]piperazine-1-carboxylate (PubChem CID 129029139) has the molecular formula C24H24ClIN4O3 and a molecular weight of 578.84 g/mol. Its IUPAC name is 3-iodopropyl 4-[2-(2-aminophenyl)-4-chloroquinoline-7-carbonyl]piperazine-1-carboxylate.
| Compound Name | 3-iodopropyl 4-[2-(2-aminophenyl)-4-chloroquinoline-7-carbonyl]piperazine-1-carboxylate |
|---|---|
| PubChem CID | 129029139 |
| Molecular Formula | C24H24ClIN4O3 |
| Molecular Weight | 578.84 g/mol |
| Exact Mass | 578.06 |
| IUPAC Name | 3-iodopropyl 4-[2-(2-aminophenyl)-4-chloroquinoline-7-carbonyl]piperazine-1-carboxylate |
| SMILES | Nc1ccccc1-c1cc(Cl)c2ccc(C(=O)N3CCN(C(=O)OCCCI)CC3)cc2n1 |
| InChI | InChI=1S/C24H24ClIN4O3/c25-19-15-22(18-4-1-2-5-20(18)27)28-21-14-16(6-7-17(19)21)23(31)29-9-11-30(12-10-29)24(32)33-13-3-8-26/h1-2,4-7,14-15H,3,8-13,27H2 |
| InChIKey | JMMCTXRFCFBCJS-UHFFFAOYSA-N |
| XLogP | 4.86 |
| TPSA | 88.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 578.84 |
| LogP ≤ 5 | 4.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|