C24H28ClN5O3 — CID 145292842
butyl 4-[4-chloro-2-(1-methylpyrazol-4-yl)quinoline-7-carbonyl]-3-methylpiperazine-1-carboxylate (PubChem CID 145292842) has the molecular formula C24H28ClN5O3 and a molecular weight of 469.97 g/mol. Its IUPAC name is butyl 4-[4-chloro-2-(1-methylpyrazol-4-yl)quinoline-7-carbonyl]-3-methylpiperazine-1-carboxylate.
| Compound Name | butyl 4-[4-chloro-2-(1-methylpyrazol-4-yl)quinoline-7-carbonyl]-3-methylpiperazine-1-carboxylate |
|---|---|
| PubChem CID | 145292842 |
| Molecular Formula | C24H28ClN5O3 |
| Molecular Weight | 469.97 g/mol |
| Exact Mass | 469.19 |
| IUPAC Name | butyl 4-[4-chloro-2-(1-methylpyrazol-4-yl)quinoline-7-carbonyl]-3-methylpiperazine-1-carboxylate |
| SMILES | CCCCOC(=O)N1CCN(C(=O)c2ccc3c(Cl)cc(-c4cnn(C)c4)nc3c2)C(C)C1 |
| InChI | InChI=1S/C24H28ClN5O3/c1-4-5-10-33-24(32)29-8-9-30(16(2)14-29)23(31)17-6-7-19-20(25)12-21(27-22(19)11-17)18-13-26-28(3)15-18/h6-7,11-13,15-16H,4-5,8-10,14H2,1-3H3 |
| InChIKey | XMUFSURPUVTUNB-UHFFFAOYSA-N |
| XLogP | 4.37 |
| TPSA | 80.56 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 469.97 |
| LogP ≤ 5 | 4.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|