C25H28ClN5O4 — CID 145292676
propyl (2S)-2-amino-4-[2-[3-(aminomethyl)-4-hydroxyphenyl]-4-chloroquinoline-7-carbonyl]piperazine-1-carboxylate (PubChem CID 145292676) has the molecular formula C25H28ClN5O4 and a molecular weight of 497.98 g/mol. Its IUPAC name is propyl (2S)-2-amino-4-[2-[3-(aminomethyl)-4-hydroxyphenyl]-4-chloroquinoline-7-carbonyl]piperazine-1-carboxylate.
| Compound Name | propyl (2S)-2-amino-4-[2-[3-(aminomethyl)-4-hydroxyphenyl]-4-chloroquinoline-7-carbonyl]piperazine-1-carboxylate |
|---|---|
| PubChem CID | 145292676 |
| Molecular Formula | C25H28ClN5O4 |
| Molecular Weight | 497.98 g/mol |
| Exact Mass | 497.18 |
| IUPAC Name | propyl (2S)-2-amino-4-[2-[3-(aminomethyl)-4-hydroxyphenyl]-4-chloroquinoline-7-carbonyl]piperazine-1-carboxylate |
| SMILES | CCCOC(=O)N1CCN(C(=O)c2ccc3c(Cl)cc(-c4ccc(O)c(CN)c4)nc3c2)C[C@H]1N |
| InChI | InChI=1S/C25H28ClN5O4/c1-2-9-35-25(34)31-8-7-30(14-23(31)28)24(33)16-3-5-18-19(26)12-20(29-21(18)11-16)15-4-6-22(32)17(10-15)13-27/h3-6,10-12,23,32H,2,7-9,13-14,27-28H2,1H3/t23-/m0/s1 |
| InChIKey | MDZPWTRVKPSVLU-QHCPKHFHSA-N |
| XLogP | 3.31 |
| TPSA | 135.01 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 497.98 |
| LogP ≤ 5 | 3.31 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'} |
|---|