C29H32ClN3O4 — CID 145292172
propyl (2R)-4-[4-chloro-2-[4-(2-hydroxybut-3-en-2-yl)phenyl]quinoline-7-carbonyl]-2-methylpiperazine-1-carboxylate (PubChem CID 145292172) has the molecular formula C29H32ClN3O4 and a molecular weight of 522.05 g/mol. Its IUPAC name is propyl (2R)-4-[4-chloro-2-[4-(2-hydroxybut-3-en-2-yl)phenyl]quinoline-7-carbonyl]-2-methylpiperazine-1-carboxylate.
| Compound Name | propyl (2R)-4-[4-chloro-2-[4-(2-hydroxybut-3-en-2-yl)phenyl]quinoline-7-carbonyl]-2-methylpiperazine-1-carboxylate |
|---|---|
| PubChem CID | 145292172 |
| Molecular Formula | C29H32ClN3O4 |
| Molecular Weight | 522.05 g/mol |
| Exact Mass | 521.21 |
| IUPAC Name | propyl (2R)-4-[4-chloro-2-[4-(2-hydroxybut-3-en-2-yl)phenyl]quinoline-7-carbonyl]-2-methylpiperazine-1-carboxylate |
| SMILES | C=CC(C)(O)c1ccc(-c2cc(Cl)c3ccc(C(=O)N4CCN(C(=O)OCCC)[C@H](C)C4)cc3n2)cc1 |
| InChI | InChI=1S/C29H32ClN3O4/c1-5-15-37-28(35)33-14-13-32(18-19(33)3)27(34)21-9-12-23-24(30)17-25(31-26(23)16-21)20-7-10-22(11-8-20)29(4,36)6-2/h6-12,16-17,19,36H,2,5,13-15,18H2,1,3-4H3/t19-,29?/m1/s1 |
| InChIKey | QXXXVNDDPWQTBF-COBFLCELSA-N |
| XLogP | 5.64 |
| TPSA | 82.97 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 522.05 |
| LogP ≤ 5 | 5.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|