C25H23ClFN3O4 — CID 129029414
propyl 4-[4-chloro-2-(4-fluoro-3-formylphenyl)quinoline-7-carbonyl]piperazine-1-carboxylate (PubChem CID 129029414) has the molecular formula C25H23ClFN3O4 and a molecular weight of 483.93 g/mol. Its IUPAC name is propyl 4-[4-chloro-2-(4-fluoro-3-formylphenyl)quinoline-7-carbonyl]piperazine-1-carboxylate.
| Compound Name | propyl 4-[4-chloro-2-(4-fluoro-3-formylphenyl)quinoline-7-carbonyl]piperazine-1-carboxylate |
|---|---|
| PubChem CID | 129029414 |
| Molecular Formula | C25H23ClFN3O4 |
| Molecular Weight | 483.93 g/mol |
| Exact Mass | 483.14 |
| IUPAC Name | propyl 4-[4-chloro-2-(4-fluoro-3-formylphenyl)quinoline-7-carbonyl]piperazine-1-carboxylate |
| SMILES | CCCOC(=O)N1CCN(C(=O)c2ccc3c(Cl)cc(-c4ccc(F)c(C=O)c4)nc3c2)CC1 |
| InChI | InChI=1S/C25H23ClFN3O4/c1-2-11-34-25(33)30-9-7-29(8-10-30)24(32)17-3-5-19-20(26)14-22(28-23(19)13-17)16-4-6-21(27)18(12-16)15-31/h3-6,12-15H,2,7-11H2,1H3 |
| InChIKey | OUKODSFCOKLHFG-UHFFFAOYSA-N |
| XLogP | 4.81 |
| TPSA | 79.81 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 483.93 |
| LogP ≤ 5 | 4.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|