C25H26ClN5O4 — CID 145292533
but-3-enyl 4-[4-chloro-2-[1-(oxetan-3-yl)pyrazol-4-yl]quinoline-7-carbonyl]piperazine-1-carboxylate (PubChem CID 145292533) has the molecular formula C25H26ClN5O4 and a molecular weight of 495.97 g/mol. Its IUPAC name is but-3-enyl 4-[4-chloro-2-[1-(oxetan-3-yl)pyrazol-4-yl]quinoline-7-carbonyl]piperazine-1-carboxylate.
| Compound Name | but-3-enyl 4-[4-chloro-2-[1-(oxetan-3-yl)pyrazol-4-yl]quinoline-7-carbonyl]piperazine-1-carboxylate |
|---|---|
| PubChem CID | 145292533 |
| Molecular Formula | C25H26ClN5O4 |
| Molecular Weight | 495.97 g/mol |
| Exact Mass | 495.17 |
| IUPAC Name | but-3-enyl 4-[4-chloro-2-[1-(oxetan-3-yl)pyrazol-4-yl]quinoline-7-carbonyl]piperazine-1-carboxylate |
| SMILES | C=CCCOC(=O)N1CCN(C(=O)c2ccc3c(Cl)cc(-c4cnn(C5COC5)c4)nc3c2)CC1 |
| InChI | InChI=1S/C25H26ClN5O4/c1-2-3-10-35-25(33)30-8-6-29(7-9-30)24(32)17-4-5-20-21(26)12-22(28-23(20)11-17)18-13-27-31(14-18)19-15-34-16-19/h2,4-5,11-14,19H,1,3,6-10,15-16H2 |
| InChIKey | DDPQNSWXJWHNMH-UHFFFAOYSA-N |
| XLogP | 3.79 |
| TPSA | 89.79 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 495.97 |
| LogP ≤ 5 | 3.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|