C25H23ClIN5O4 — CID 145292885
3-iodopropyl 4-[4-chloro-2-(2-oxo-1,3-dihydrobenzimidazol-5-yl)quinoline-7-carbonyl]piperazine-1-carboxylate (PubChem CID 145292885) has the molecular formula C25H23ClIN5O4 and a molecular weight of 619.85 g/mol. Its IUPAC name is 3-iodopropyl 4-[4-chloro-2-(2-oxo-1,3-dihydrobenzimidazol-5-yl)quinoline-7-carbonyl]piperazine-1-carboxylate.
| Compound Name | 3-iodopropyl 4-[4-chloro-2-(2-oxo-1,3-dihydrobenzimidazol-5-yl)quinoline-7-carbonyl]piperazine-1-carboxylate |
|---|---|
| PubChem CID | 145292885 |
| Molecular Formula | C25H23ClIN5O4 |
| Molecular Weight | 619.85 g/mol |
| Exact Mass | 619.05 |
| IUPAC Name | 3-iodopropyl 4-[4-chloro-2-(2-oxo-1,3-dihydrobenzimidazol-5-yl)quinoline-7-carbonyl]piperazine-1-carboxylate |
| SMILES | O=C(OCCCI)N1CCN(C(=O)c2ccc3c(Cl)cc(-c4ccc5[nH]c(=O)[nH]c5c4)nc3c2)CC1 |
| InChI | InChI=1S/C25H23ClIN5O4/c26-18-14-20(15-3-5-19-22(12-15)30-24(34)29-19)28-21-13-16(2-4-17(18)21)23(33)31-7-9-32(10-8-31)25(35)36-11-1-6-27/h2-5,12-14H,1,6-11H2,(H2,29,30,34) |
| InChIKey | ZTOXKSNGZFGGNO-UHFFFAOYSA-N |
| XLogP | 4.44 |
| TPSA | 111.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 619.85 |
| LogP ≤ 5 | 4.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|