C29H32N4O3 — CID 145292408
butyl 4-[4-methyl-2-(3-methyl-1H-indol-5-yl)quinoline-7-carbonyl]piperazine-1-carboxylate (PubChem CID 145292408) has the molecular formula C29H32N4O3 and a molecular weight of 484.60 g/mol. Its IUPAC name is butyl 4-[4-methyl-2-(3-methyl-1H-indol-5-yl)quinoline-7-carbonyl]piperazine-1-carboxylate.
| Compound Name | butyl 4-[4-methyl-2-(3-methyl-1H-indol-5-yl)quinoline-7-carbonyl]piperazine-1-carboxylate |
|---|---|
| PubChem CID | 145292408 |
| Molecular Formula | C29H32N4O3 |
| Molecular Weight | 484.60 g/mol |
| Exact Mass | 484.25 |
| IUPAC Name | butyl 4-[4-methyl-2-(3-methyl-1H-indol-5-yl)quinoline-7-carbonyl]piperazine-1-carboxylate |
| SMILES | CCCCOC(=O)N1CCN(C(=O)c2ccc3c(C)cc(-c4ccc5[nH]cc(C)c5c4)nc3c2)CC1 |
| InChI | InChI=1S/C29H32N4O3/c1-4-5-14-36-29(35)33-12-10-32(11-13-33)28(34)22-6-8-23-19(2)15-26(31-27(23)17-22)21-7-9-25-24(16-21)20(3)18-30-25/h6-9,15-18,30H,4-5,10-14H2,1-3H3 |
| InChIKey | YWGWXXIUAPHEEN-UHFFFAOYSA-N |
| XLogP | 5.69 |
| TPSA | 78.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 484.60 |
| LogP ≤ 5 | 5.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|