C27H33N3O3 — CID 145292833
butyl 3-ethynyl-3-methyl-4-(9-methyl-5,6,7,8-tetrahydroacridine-3-carbonyl)piperazine-1-carboxylate (PubChem CID 145292833) has the molecular formula C27H33N3O3 and a molecular weight of 447.58 g/mol. Its IUPAC name is butyl 3-ethynyl-3-methyl-4-(9-methyl-5,6,7,8-tetrahydroacridine-3-carbonyl)piperazine-1-carboxylate.
| Compound Name | butyl 3-ethynyl-3-methyl-4-(9-methyl-5,6,7,8-tetrahydroacridine-3-carbonyl)piperazine-1-carboxylate |
|---|---|
| PubChem CID | 145292833 |
| Molecular Formula | C27H33N3O3 |
| Molecular Weight | 447.58 g/mol |
| Exact Mass | 447.25 |
| IUPAC Name | butyl 3-ethynyl-3-methyl-4-(9-methyl-5,6,7,8-tetrahydroacridine-3-carbonyl)piperazine-1-carboxylate |
| SMILES | C#CC1(C)CN(C(=O)OCCCC)CCN1C(=O)c1ccc2c(C)c3c(nc2c1)CCCC3 |
| InChI | InChI=1S/C27H33N3O3/c1-5-7-16-33-26(32)29-14-15-30(27(4,6-2)18-29)25(31)20-12-13-22-19(3)21-10-8-9-11-23(21)28-24(22)17-20/h2,12-13,17H,5,7-11,14-16,18H2,1,3-4H3 |
| InChIKey | FZSIVNOIKXKCCE-UHFFFAOYSA-N |
| XLogP | 4.51 |
| TPSA | 62.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.58 |
| LogP ≤ 5 | 4.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|