C26H32ClN3O3 — CID 129029195
butyl 4-(9-chloro-5-prop-2-enyl-5,6,7,8-tetrahydroacridine-3-carbonyl)piperazine-1-carboxylate (PubChem CID 129029195) has the molecular formula C26H32ClN3O3 and a molecular weight of 470.01 g/mol. Its IUPAC name is butyl 4-(9-chloro-5-prop-2-enyl-5,6,7,8-tetrahydroacridine-3-carbonyl)piperazine-1-carboxylate.
| Compound Name | butyl 4-(9-chloro-5-prop-2-enyl-5,6,7,8-tetrahydroacridine-3-carbonyl)piperazine-1-carboxylate |
|---|---|
| PubChem CID | 129029195 |
| Molecular Formula | C26H32ClN3O3 |
| Molecular Weight | 470.01 g/mol |
| Exact Mass | 469.21 |
| IUPAC Name | butyl 4-(9-chloro-5-prop-2-enyl-5,6,7,8-tetrahydroacridine-3-carbonyl)piperazine-1-carboxylate |
| SMILES | C=CCC1CCCc2c1nc1cc(C(=O)N3CCN(C(=O)OCCCC)CC3)ccc1c2Cl |
| InChI | InChI=1S/C26H32ClN3O3/c1-3-5-16-33-26(32)30-14-12-29(13-15-30)25(31)19-10-11-20-22(17-19)28-24-18(7-4-2)8-6-9-21(24)23(20)27/h4,10-11,17-18H,2-3,5-9,12-16H2,1H3 |
| InChIKey | FACWYLMJDFEXLW-UHFFFAOYSA-N |
| XLogP | 5.58 |
| TPSA | 62.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.01 |
| LogP ≤ 5 | 5.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|