C25H31ClN4O4 — CID 145292887
butyl 4-[7-(2-amino-2-oxoethyl)-9-chloro-5,6,7,8-tetrahydroacridine-3-carbonyl]piperazine-1-carboxylate (PubChem CID 145292887) has the molecular formula C25H31ClN4O4 and a molecular weight of 487.00 g/mol. Its IUPAC name is butyl 4-[7-(2-amino-2-oxoethyl)-9-chloro-5,6,7,8-tetrahydroacridine-3-carbonyl]piperazine-1-carboxylate.
| Compound Name | butyl 4-[7-(2-amino-2-oxoethyl)-9-chloro-5,6,7,8-tetrahydroacridine-3-carbonyl]piperazine-1-carboxylate |
|---|---|
| PubChem CID | 145292887 |
| Molecular Formula | C25H31ClN4O4 |
| Molecular Weight | 487.00 g/mol |
| Exact Mass | 486.20 |
| IUPAC Name | butyl 4-[7-(2-amino-2-oxoethyl)-9-chloro-5,6,7,8-tetrahydroacridine-3-carbonyl]piperazine-1-carboxylate |
| SMILES | CCCCOC(=O)N1CCN(C(=O)c2ccc3c(Cl)c4c(nc3c2)CCC(CC(N)=O)C4)CC1 |
| InChI | InChI=1S/C25H31ClN4O4/c1-2-3-12-34-25(33)30-10-8-29(9-11-30)24(32)17-5-6-18-21(15-17)28-20-7-4-16(14-22(27)31)13-19(20)23(18)26/h5-6,15-16H,2-4,7-14H2,1H3,(H2,27,31) |
| InChIKey | RPBXPHLBRIIPKA-UHFFFAOYSA-N |
| XLogP | 3.56 |
| TPSA | 105.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 487.00 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|