C25H29ClN4O3 — CID 174910822
[2-(4-aminophenyl)-4-chloroquinolin-7-yl]-[(3R)-3-methylpiperazin-1-yl]methanone;butanoic acid (PubChem CID 174910822) has the molecular formula C25H29ClN4O3 and a molecular weight of 468.99 g/mol. Its IUPAC name is [2-(4-aminophenyl)-4-chloroquinolin-7-yl]-[(3R)-3-methylpiperazin-1-yl]methanone;butanoic acid.
| Compound Name | [2-(4-aminophenyl)-4-chloroquinolin-7-yl]-[(3R)-3-methylpiperazin-1-yl]methanone;butanoic acid |
|---|---|
| PubChem CID | 174910822 |
| Molecular Formula | C25H29ClN4O3 |
| Molecular Weight | 468.99 g/mol |
| Exact Mass | 468.19 |
| IUPAC Name | [2-(4-aminophenyl)-4-chloroquinolin-7-yl]-[(3R)-3-methylpiperazin-1-yl]methanone;butanoic acid |
| SMILES | CCCC(=O)O.C[C@@H]1CN(C(=O)c2ccc3c(Cl)cc(-c4ccc(N)cc4)nc3c2)CCN1 |
| InChI | InChI=1S/C21H21ClN4O.C4H8O2/c1-13-12-26(9-8-24-13)21(27)15-4-7-17-18(22)11-19(25-20(17)10-15)14-2-5-16(23)6-3-14;1-2-3-4(5)6/h2-7,10-11,13,24H,8-9,12,23H2,1H3;2-3H2,1H3,(H,5,6)/t13-;/m1./s1 |
| InChIKey | CXMUGBGNHLDVOJ-BTQNPOSSSA-N |
| XLogP | 4.44 |
| TPSA | 108.55 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.99 |
| LogP ≤ 5 | 4.44 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|