C31H26N4O3 — CID 129031804
3-(4-phenoxyphenyl)-1-[(3R)-1-[(E)-3-phenylprop-2-enoyl]pyrrolidin-3-yl]imidazo[4,5-c]pyridin-2-one (PubChem CID 129031804) has the molecular formula C31H26N4O3 and a molecular weight of 502.57 g/mol. Its IUPAC name is 3-(4-phenoxyphenyl)-1-[(3R)-1-[(E)-3-phenylprop-2-enoyl]pyrrolidin-3-yl]imidazo[4,5-c]pyridin-2-one.
| Compound Name | 3-(4-phenoxyphenyl)-1-[(3R)-1-[(E)-3-phenylprop-2-enoyl]pyrrolidin-3-yl]imidazo[4,5-c]pyridin-2-one |
|---|---|
| PubChem CID | 129031804 |
| Molecular Formula | C31H26N4O3 |
| Molecular Weight | 502.57 g/mol |
| Exact Mass | 502.20 |
| IUPAC Name | 3-(4-phenoxyphenyl)-1-[(3R)-1-[(E)-3-phenylprop-2-enoyl]pyrrolidin-3-yl]imidazo[4,5-c]pyridin-2-one |
| SMILES | O=C(/C=C/c1ccccc1)N1CC[C@@H](n2c(=O)n(-c3ccc(Oc4ccccc4)cc3)c3cnccc32)C1 |
| InChI | InChI=1S/C31H26N4O3/c36-30(16-11-23-7-3-1-4-8-23)33-20-18-25(22-33)35-28-17-19-32-21-29(28)34(31(35)37)24-12-14-27(15-13-24)38-26-9-5-2-6-10-26/h1-17,19,21,25H,18,20,22H2/b16-11+/t25-/m1/s1 |
| InChIKey | RSLLOXBMGDPVHI-XAJMEMKASA-N |
| XLogP | 5.47 |
| TPSA | 69.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 502.57 |
| LogP ≤ 5 | 5.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|