C26H23ClN4O3 — CID 129031940
3-(3-chloro-4-phenoxyphenyl)-1-(1-prop-2-enoylpiperidin-3-yl)imidazo[4,5-c]pyridin-2-one (PubChem CID 129031940) has the molecular formula C26H23ClN4O3 and a molecular weight of 474.95 g/mol. Its IUPAC name is 3-(3-chloro-4-phenoxyphenyl)-1-(1-prop-2-enoylpiperidin-3-yl)imidazo[4,5-c]pyridin-2-one.
| Compound Name | 3-(3-chloro-4-phenoxyphenyl)-1-(1-prop-2-enoylpiperidin-3-yl)imidazo[4,5-c]pyridin-2-one |
|---|---|
| PubChem CID | 129031940 |
| Molecular Formula | C26H23ClN4O3 |
| Molecular Weight | 474.95 g/mol |
| Exact Mass | 474.15 |
| IUPAC Name | 3-(3-chloro-4-phenoxyphenyl)-1-(1-prop-2-enoylpiperidin-3-yl)imidazo[4,5-c]pyridin-2-one |
| SMILES | C=CC(=O)N1CCCC(n2c(=O)n(-c3ccc(Oc4ccccc4)c(Cl)c3)c3cnccc32)C1 |
| InChI | InChI=1S/C26H23ClN4O3/c1-2-25(32)29-14-6-7-19(17-29)31-22-12-13-28-16-23(22)30(26(31)33)18-10-11-24(21(27)15-18)34-20-8-4-3-5-9-20/h2-5,8-13,15-16,19H,1,6-7,14,17H2 |
| InChIKey | KWMZONLAJYAKJS-UHFFFAOYSA-N |
| XLogP | 4.98 |
| TPSA | 69.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.95 |
| LogP ≤ 5 | 4.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|