C26H20ClF3N4O3 — CID 129032162
3-[3-chloro-4-[3-(trifluoromethyl)phenoxy]phenyl]-1-(1-prop-2-enoylpyrrolidin-3-yl)imidazo[4,5-c]pyridin-2-one (PubChem CID 129032162) has the molecular formula C26H20ClF3N4O3 and a molecular weight of 528.92 g/mol. Its IUPAC name is 3-[3-chloro-4-[3-(trifluoromethyl)phenoxy]phenyl]-1-(1-prop-2-enoylpyrrolidin-3-yl)imidazo[4,5-c]pyridin-2-one.
| Compound Name | 3-[3-chloro-4-[3-(trifluoromethyl)phenoxy]phenyl]-1-(1-prop-2-enoylpyrrolidin-3-yl)imidazo[4,5-c]pyridin-2-one |
|---|---|
| PubChem CID | 129032162 |
| Molecular Formula | C26H20ClF3N4O3 |
| Molecular Weight | 528.92 g/mol |
| Exact Mass | 528.12 |
| IUPAC Name | 3-[3-chloro-4-[3-(trifluoromethyl)phenoxy]phenyl]-1-(1-prop-2-enoylpyrrolidin-3-yl)imidazo[4,5-c]pyridin-2-one |
| SMILES | C=CC(=O)N1CCC(n2c(=O)n(-c3ccc(Oc4cccc(C(F)(F)F)c4)c(Cl)c3)c3cnccc32)C1 |
| InChI | InChI=1S/C26H20ClF3N4O3/c1-2-24(35)32-11-9-18(15-32)34-21-8-10-31-14-22(21)33(25(34)36)17-6-7-23(20(27)13-17)37-19-5-3-4-16(12-19)26(28,29)30/h2-8,10,12-14,18H,1,9,11,15H2 |
| InChIKey | GGBAJDKETAJIKK-UHFFFAOYSA-N |
| XLogP | 5.61 |
| TPSA | 69.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 528.92 |
| LogP ≤ 5 | 5.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|