C25H20Cl2N4O3 — CID 129051787
3-[4-(3,4-dichlorophenoxy)phenyl]-1-[(3R)-1-prop-2-enoylpyrrolidin-3-yl]imidazo[4,5-c]pyridin-2-one (PubChem CID 129051787) has the molecular formula C25H20Cl2N4O3 and a molecular weight of 495.37 g/mol. Its IUPAC name is 3-[4-(3,4-dichlorophenoxy)phenyl]-1-[(3R)-1-prop-2-enoylpyrrolidin-3-yl]imidazo[4,5-c]pyridin-2-one.
| Compound Name | 3-[4-(3,4-dichlorophenoxy)phenyl]-1-[(3R)-1-prop-2-enoylpyrrolidin-3-yl]imidazo[4,5-c]pyridin-2-one |
|---|---|
| PubChem CID | 129051787 |
| Molecular Formula | C25H20Cl2N4O3 |
| Molecular Weight | 495.37 g/mol |
| Exact Mass | 494.09 |
| IUPAC Name | 3-[4-(3,4-dichlorophenoxy)phenyl]-1-[(3R)-1-prop-2-enoylpyrrolidin-3-yl]imidazo[4,5-c]pyridin-2-one |
| SMILES | C=CC(=O)N1CC[C@@H](n2c(=O)n(-c3ccc(Oc4ccc(Cl)c(Cl)c4)cc3)c3cnccc32)C1 |
| InChI | InChI=1S/C25H20Cl2N4O3/c1-2-24(32)29-12-10-17(15-29)31-22-9-11-28-14-23(22)30(25(31)33)16-3-5-18(6-4-16)34-19-7-8-20(26)21(27)13-19/h2-9,11,13-14,17H,1,10,12,15H2/t17-/m1/s1 |
| InChIKey | UZVFTKSUZFRZBE-QGZVFWFLSA-N |
| XLogP | 5.25 |
| TPSA | 69.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 495.37 |
| LogP ≤ 5 | 5.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|