C13H22N2 — CID 129031822
1-(4-ethyl-4-methylcyclohexa-1,5-dien-1-yl)piperazine (PubChem CID 129031822) has the molecular formula C13H22N2 and a molecular weight of 206.33 g/mol. Its IUPAC name is 1-(4-ethyl-4-methylcyclohexa-1,5-dien-1-yl)piperazine.
| Compound Name | 1-(4-ethyl-4-methylcyclohexa-1,5-dien-1-yl)piperazine |
|---|---|
| PubChem CID | 129031822 |
| Molecular Formula | C13H22N2 |
| Molecular Weight | 206.33 g/mol |
| Exact Mass | 206.18 |
| IUPAC Name | 1-(4-ethyl-4-methylcyclohexa-1,5-dien-1-yl)piperazine |
| SMILES | CCC1(C)C=CC(N2CCNCC2)=CC1 |
| InChI | InChI=1S/C13H22N2/c1-3-13(2)6-4-12(5-7-13)15-10-8-14-9-11-15/h4-6,14H,3,7-11H2,1-2H3 |
| InChIKey | JPXDYIYPWZVQSI-UHFFFAOYSA-N |
| XLogP | 2.15 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 206.33 |
| LogP ≤ 5 | 2.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |