C10H17N3 — CID 86340381
1-(1,2-dihydropyridin-4-yl)-1,4-diazepane (PubChem CID 86340381) has the molecular formula C10H17N3 and a molecular weight of 179.27 g/mol. Its IUPAC name is 1-(1,2-dihydropyridin-4-yl)-1,4-diazepane.
| Compound Name | 1-(1,2-dihydropyridin-4-yl)-1,4-diazepane |
|---|---|
| PubChem CID | 86340381 |
| Molecular Formula | C10H17N3 |
| Molecular Weight | 179.27 g/mol |
| Exact Mass | 179.14 |
| IUPAC Name | 1-(1,2-dihydropyridin-4-yl)-1,4-diazepane |
| SMILES | C1=CC(N2CCCNCC2)=CCN1 |
| InChI | InChI=1S/C10H17N3/c1-4-11-7-9-13(8-1)10-2-5-12-6-3-10/h2-3,5,11-12H,1,4,6-9H2 |
| InChIKey | MOPJDUHUZFCFMB-UHFFFAOYSA-N |
| XLogP | 0.28 |
| TPSA | 27.30 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 179.27 |
| LogP ≤ 5 | 0.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |