C26H24N4O3 — CID 129031881
6-(2-oxo-1-pyrrolidin-2-ylbut-3-enyl)-3-(4-phenoxyphenyl)-1H-imidazo[4,5-c]pyridin-2-one (PubChem CID 129031881) has the molecular formula C26H24N4O3 and a molecular weight of 440.50 g/mol. Its IUPAC name is 6-(2-oxo-1-pyrrolidin-2-ylbut-3-enyl)-3-(4-phenoxyphenyl)-1H-imidazo[4,5-c]pyridin-2-one.
| Compound Name | 6-(2-oxo-1-pyrrolidin-2-ylbut-3-enyl)-3-(4-phenoxyphenyl)-1H-imidazo[4,5-c]pyridin-2-one |
|---|---|
| PubChem CID | 129031881 |
| Molecular Formula | C26H24N4O3 |
| Molecular Weight | 440.50 g/mol |
| Exact Mass | 440.18 |
| IUPAC Name | 6-(2-oxo-1-pyrrolidin-2-ylbut-3-enyl)-3-(4-phenoxyphenyl)-1H-imidazo[4,5-c]pyridin-2-one |
| SMILES | C=CC(=O)C(c1cc2[nH]c(=O)n(-c3ccc(Oc4ccccc4)cc3)c2cn1)C1CCCN1 |
| InChI | InChI=1S/C26H24N4O3/c1-2-24(31)25(20-9-6-14-27-20)22-15-21-23(16-28-22)30(26(32)29-21)17-10-12-19(13-11-17)33-18-7-4-3-5-8-18/h2-5,7-8,10-13,15-16,20,25,27H,1,6,9,14H2,(H,29,32) |
| InChIKey | HKTAUOINSFRTJC-UHFFFAOYSA-N |
| XLogP | 4.10 |
| TPSA | 89.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.50 |
| LogP ≤ 5 | 4.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|