C27H27N5O3 — CID 126700572
4-amino-3-(4-phenoxyphenyl)-1-[(1-prop-2-enoylpiperidin-3-yl)methyl]imidazo[4,5-c]pyridin-2-one (PubChem CID 126700572) has the molecular formula C27H27N5O3 and a molecular weight of 469.55 g/mol. Its IUPAC name is 4-amino-3-(4-phenoxyphenyl)-1-[(1-prop-2-enoylpiperidin-3-yl)methyl]imidazo[4,5-c]pyridin-2-one.
| Compound Name | 4-amino-3-(4-phenoxyphenyl)-1-[(1-prop-2-enoylpiperidin-3-yl)methyl]imidazo[4,5-c]pyridin-2-one |
|---|---|
| PubChem CID | 126700572 |
| Molecular Formula | C27H27N5O3 |
| Molecular Weight | 469.55 g/mol |
| Exact Mass | 469.21 |
| IUPAC Name | 4-amino-3-(4-phenoxyphenyl)-1-[(1-prop-2-enoylpiperidin-3-yl)methyl]imidazo[4,5-c]pyridin-2-one |
| SMILES | C=CC(=O)N1CCCC(Cn2c(=O)n(-c3ccc(Oc4ccccc4)cc3)c3c(N)nccc32)C1 |
| InChI | InChI=1S/C27H27N5O3/c1-2-24(33)30-16-6-7-19(17-30)18-31-23-14-15-29-26(28)25(23)32(27(31)34)20-10-12-22(13-11-20)35-21-8-4-3-5-9-21/h2-5,8-15,19H,1,6-7,16-18H2,(H2,28,29) |
| InChIKey | SEHJKCMZXFTAAS-UHFFFAOYSA-N |
| XLogP | 3.99 |
| TPSA | 95.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 469.55 |
| LogP ≤ 5 | 3.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|