C26H26ClN5O3 — CID 168956416
4-amino-1-[(3R)-1-(3-chloropropanoyl)piperidin-3-yl]-3-(4-phenoxyphenyl)imidazo[4,5-c]pyridin-2-one (PubChem CID 168956416) has the molecular formula C26H26ClN5O3 and a molecular weight of 491.98 g/mol. Its IUPAC name is 4-amino-1-[(3R)-1-(3-chloropropanoyl)piperidin-3-yl]-3-(4-phenoxyphenyl)imidazo[4,5-c]pyridin-2-one.
| Compound Name | 4-amino-1-[(3R)-1-(3-chloropropanoyl)piperidin-3-yl]-3-(4-phenoxyphenyl)imidazo[4,5-c]pyridin-2-one |
|---|---|
| PubChem CID | 168956416 |
| Molecular Formula | C26H26ClN5O3 |
| Molecular Weight | 491.98 g/mol |
| Exact Mass | 491.17 |
| IUPAC Name | 4-amino-1-[(3R)-1-(3-chloropropanoyl)piperidin-3-yl]-3-(4-phenoxyphenyl)imidazo[4,5-c]pyridin-2-one |
| SMILES | Nc1nccc2c1n(-c1ccc(Oc3ccccc3)cc1)c(=O)n2[C@@H]1CCCN(C(=O)CCCl)C1 |
| InChI | InChI=1S/C26H26ClN5O3/c27-14-12-23(33)30-16-4-5-19(17-30)31-22-13-15-29-25(28)24(22)32(26(31)34)18-8-10-21(11-9-18)35-20-6-2-1-3-7-20/h1-3,6-11,13,15,19H,4-5,12,14,16-17H2,(H2,28,29)/t19-/m1/s1 |
| InChIKey | ZWVDFEVDGSJLOQ-LJQANCHMSA-N |
| XLogP | 4.35 |
| TPSA | 95.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 491.98 |
| LogP ≤ 5 | 4.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|