C32H28N6O4S — CID 175559202
2-[(3R)-3-[4-amino-2-oxo-3-(4-phenoxyphenyl)imidazo[4,5-c]pyridin-1-yl]piperidine-1-carbonyl]-3-[(1R)-1-oxo-2H-thiopyran-4-yl]prop-2-enenitrile (PubChem CID 175559202) has the molecular formula C32H28N6O4S and a molecular weight of 592.68 g/mol. Its IUPAC name is 2-[(3R)-3-[4-amino-2-oxo-3-(4-phenoxyphenyl)imidazo[4,5-c]pyridin-1-yl]piperidine-1-carbonyl]-3-[(1R)-1-oxo-2H-thiopyran-4-yl]prop-2-enenitrile.
| Compound Name | 2-[(3R)-3-[4-amino-2-oxo-3-(4-phenoxyphenyl)imidazo[4,5-c]pyridin-1-yl]piperidine-1-carbonyl]-3-[(1R)-1-oxo-2H-thiopyran-4-yl]prop-2-enenitrile |
|---|---|
| PubChem CID | 175559202 |
| Molecular Formula | C32H28N6O4S |
| Molecular Weight | 592.68 g/mol |
| Exact Mass | 592.19 |
| IUPAC Name | 2-[(3R)-3-[4-amino-2-oxo-3-(4-phenoxyphenyl)imidazo[4,5-c]pyridin-1-yl]piperidine-1-carbonyl]-3-[(1R)-1-oxo-2H-thiopyran-4-yl]prop-2-enenitrile |
| SMILES | N#CC(=CC1=CC[S@@](=O)C=C1)C(=O)N1CCC[C@@H](n2c(=O)n(-c3ccc(Oc4ccccc4)cc3)c3c(N)nccc32)C1 |
| InChI | InChI=1S/C32H28N6O4S/c33-20-23(19-22-13-17-43(41)18-14-22)31(39)36-16-4-5-25(21-36)37-28-12-15-35-30(34)29(28)38(32(37)40)24-8-10-27(11-9-24)42-26-6-2-1-3-7-26/h1-3,6-15,17,19,25H,4-5,16,18,21H2,(H2,34,35)/t25-,43+/m1/s1 |
| InChIKey | VXOWNYONAVSTLV-ZBKGWTFESA-N |
| XLogP | 4.38 |
| TPSA | 136.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 43 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 592.68 |
| LogP ≤ 5 | 4.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|